C11H19N — CID 90801555
N,N-dimethylnona-2,4,6-trien-4-amine (PubChem CID 90801555) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N,N-dimethylnona-2,4,6-trien-4-amine.
| Compound Name | N,N-dimethylnona-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 90801555 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N,N-dimethylnona-2,4,6-trien-4-amine |
| SMILES | CC=CC(=CC=CCC)N(C)C |
| InChI | InChI=1S/C11H19N/c1-5-7-8-10-11(9-6-2)12(3)4/h6-10H,5H2,1-4H3 |
| InChIKey | QHFMVYPBKXJLSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|