About 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine
3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine (PubChem CID 90802411) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine.
Molecular Properties
| Compound Name | 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine |
| PubChem CID | 90802411 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine |
| SMILES | CCN1CCCC(c2ccc(C3=NCCN3)cc2)C1 |
| InChI | InChI=1S/C16H23N3/c1-2-19-11-3-4-15(12-19)13-5-7-14(8-6-13)16-17-9-10-18-16/h5-8,15H,2-4,9-12H2,1H3,(H,17,18) |
| InChIKey | XOTYHAKZOLZOGK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine?
The IUPAC name of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine (CID 90802411) is 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine.
What is the SMILES notation for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine?
The canonical SMILES for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine is CCN1CCCC(c2ccc(C3=NCCN3)cc2)C1.
What is the InChIKey of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine?
The InChIKey is XOTYHAKZOLZOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-2-19-11-3-4-15(12-19)13-5-7-14(8-6-13)16-17-9-10-18-16/h5-8,15H,2-4,9-12H2,1H3,(H,17,18).
What are the key properties of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine?
3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine has a molecular weight of 257.38 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-ethylpiperidine is sourced from PubChem (CID 90802411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).