C14H16N4O — CID 90803666
5-benzyl-1H-pyrazolo[4,3-c]pyridazin-6-one;ethane (PubChem CID 90803666) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 5-benzyl-1H-pyrazolo[4,3-c]pyridazin-6-one;ethane.
| Compound Name | 5-benzyl-1H-pyrazolo[4,3-c]pyridazin-6-one;ethane |
|---|---|
| PubChem CID | 90803666 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-benzyl-1H-pyrazolo[4,3-c]pyridazin-6-one;ethane |
| SMILES | CC.O=c1cc2[nH]ncc2nn1Cc1ccccc1 |
| InChI | InChI=1S/C12H10N4O.C2H6/c17-12-6-10-11(7-13-14-10)15-16(12)8-9-4-2-1-3-5-9;1-2/h1-7,14H,8H2;1-2H3 |
| InChIKey | HKWLWWWCXXOVQP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |