C16H17N3O2 — CID 90803675
1-(3-ethynoxyphenyl)ethanone;2,4,6-trimethyl-1,3,5-triazine (PubChem CID 90803675) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(3-ethynoxyphenyl)ethanone;2,4,6-trimethyl-1,3,5-triazine.
| Compound Name | 1-(3-ethynoxyphenyl)ethanone;2,4,6-trimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 90803675 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(3-ethynoxyphenyl)ethanone;2,4,6-trimethyl-1,3,5-triazine |
| SMILES | C#COc1cccc(C(C)=O)c1.Cc1nc(C)nc(C)n1 |
| InChI | InChI=1S/C10H8O2.C6H9N3/c1-3-12-10-6-4-5-9(7-10)8(2)11;1-4-7-5(2)9-6(3)8-4/h1,4-7H,2H3;1-3H3 |
| InChIKey | AQPJZNYYJGUNLU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|