C13H23N — CID 90805601
(Z)-6,9-dimethyl-4-methylidenedec-6-en-5-imine (PubChem CID 90805601) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (Z)-6,9-dimethyl-4-methylidenedec-6-en-5-imine.
| Compound Name | (Z)-6,9-dimethyl-4-methylidenedec-6-en-5-imine |
|---|---|
| PubChem CID | 90805601 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (Z)-6,9-dimethyl-4-methylidenedec-6-en-5-imine |
| SMILES | [H]/N=C(C(=C)CCC)/C(C)=C\CC(C)C |
| InChI | InChI=1S/C13H23N/c1-6-7-11(4)13(14)12(5)9-8-10(2)3/h9-10,14H,4,6-8H2,1-3,5H3/b12-9-,14-13+ |
| InChIKey | FGQYZYIBUNHDHE-FCCMOTEVSA-N |
| XLogP | 4.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|