C16H22N8 — CID 90806001
N,2-dimethyl-8-[5-(pyrimidin-2-ylamino)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 90806001) has the molecular formula C16H22N8 and a molecular weight of 326.41 g/mol. Its IUPAC name is N,2-dimethyl-8-[5-(pyrimidin-2-ylamino)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N,2-dimethyl-8-[5-(pyrimidin-2-ylamino)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 90806001 |
| Molecular Formula | C16H22N8 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N,2-dimethyl-8-[5-(pyrimidin-2-ylamino)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CNc1nc(C)nc2c(CCCCCNc3ncccn3)cnn12 |
| InChI | InChI=1S/C16H22N8/c1-12-22-14-13(11-21-24(14)16(17-2)23-12)7-4-3-5-8-18-15-19-9-6-10-20-15/h6,9-11H,3-5,7-8H2,1-2H3,(H,17,22,23)(H,18,19,20) |
| InChIKey | LKANVDBQTOTYLF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|