C18H16ClN3 — CID 90808745
6-[(4-chlorophenyl)methyl]-2-ethynyl-7-propylpyrrolo[2,3-d]pyrimidine (PubChem CID 90808745) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-2-ethynyl-7-propylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 6-[(4-chlorophenyl)methyl]-2-ethynyl-7-propylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 90808745 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-2-ethynyl-7-propylpyrrolo[2,3-d]pyrimidine |
| SMILES | C#Cc1ncc2cc(Cc3ccc(Cl)cc3)n(CCC)c2n1 |
| InChI | InChI=1S/C18H16ClN3/c1-3-9-22-16(10-13-5-7-15(19)8-6-13)11-14-12-20-17(4-2)21-18(14)22/h2,5-8,11-12H,3,9-10H2,1H3 |
| InChIKey | UVOQYACPSAYPAS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|