C23H18F3N5O4 — CID 90809807
N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]-3-pyridinyl]benzohydrazide (PubChem CID 90809807) has the molecular formula C23H18F3N5O4 and a molecular weight of 485.42 g/mol. Its IUPAC name is N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]-3-pyridinyl]benzohydrazide.
| Compound Name | N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]-3-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 90809807 |
| Molecular Formula | C23H18F3N5O4 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N'-[4-[[4-hydroxy-2-oxo-3-[4-(trifluoromethoxy)phenyl]imidazol-1-yl]methyl]-3-pyridinyl]benzohydrazide |
| SMILES | O=C(NNc1cnccc1Cn1cc(O)n(-c2ccc(OC(F)(F)F)cc2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H18F3N5O4/c24-23(25,26)35-18-8-6-17(7-9-18)31-20(32)14-30(22(31)34)13-16-10-11-27-12-19(16)28-29-21(33)15-4-2-1-3-5-15/h1-12,14,28,32H,13H2,(H,29,33) |
| InChIKey | PLWPKFHXVAHZSE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|