C29H20F2N3S+ — CID 90810981
2-(2,3-difluorophenyl)-5-[[4-(4-thiophen-2-ylphenyl)phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 90810981) has the molecular formula C29H20F2N3S+ and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-[[4-(4-thiophen-2-ylphenyl)phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(2,3-difluorophenyl)-5-[[4-(4-thiophen-2-ylphenyl)phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 90810981 |
| Molecular Formula | C29H20F2N3S+ |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-[[4-(4-thiophen-2-ylphenyl)phenyl]methyl]-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Fc1cccc(-c2nc3cc[n+](Cc4ccc(-c5ccc(-c6cccs6)cc5)cc4)cc3[nH]2)c1F |
| InChI | InChI=1S/C29H19F2N3S/c30-24-4-1-3-23(28(24)31)29-32-25-14-15-34(18-26(25)33-29)17-19-6-8-20(9-7-19)21-10-12-22(13-11-21)27-5-2-16-35-27/h1-16,18H,17H2/p+1 |
| InChIKey | GAABNSYPXLCZPR-UHFFFAOYSA-O |
| XLogP | 7.24 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|