C33H54N8O4 — CID 90811184
6-amino-N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[5-[(1-amino-2-methylbutylidene)amino]-2-(4-methylpentanoylamino)pentanoyl]amino]hexanamide (PubChem CID 90811184) has the molecular formula C33H54N8O4 and a molecular weight of 626.85 g/mol. Its IUPAC name is 6-amino-N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[5-[(1-amino-2-methylbutylidene)amino]-2-(4-methylpentanoylamino)pentanoyl]amino]hexanamide.
| Compound Name | 6-amino-N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[5-[(1-amino-2-methylbutylidene)amino]-2-(4-methylpentanoylamino)pentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 90811184 |
| Molecular Formula | C33H54N8O4 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | 6-amino-N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[5-[(1-amino-2-methylbutylidene)amino]-2-(4-methylpentanoylamino)pentanoyl]amino]hexanamide |
| SMILES | CCC(C)/C(N)=N/CCCC(NC(=O)CCC(C)C)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C33H54N8O4/c1-5-22(4)30(35)37-18-10-14-26(39-29(42)16-15-21(2)3)32(44)40-27(13-8-9-17-34)33(45)41-28(31(36)43)19-23-20-38-25-12-7-6-11-24(23)25/h6-7,11-12,20-22,26-28,38H,5,8-10,13-19,34H2,1-4H3,(H2,35,37)(H2,36,43)(H,39,42)(H,40,44)(H,41,45) |
| InChIKey | KBPQBGWYVLBAMF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 210.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|