C57H79N7O2+2 — CID 90813493
decyl-[3-[4-[15-[4-[3-[3-(dimethylamino)propyl-dimethylazaniumyl]propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]-dimethylazanium (PubChem CID 90813493) has the molecular formula C57H79N7O2+2 and a molecular weight of 894.31 g/mol. Its IUPAC name is decyl-[3-[4-[15-[4-[3-[3-(dimethylamino)propyl-dimethylazaniumyl]propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]-dimethylazanium.
| Compound Name | decyl-[3-[4-[15-[4-[3-[3-(dimethylamino)propyl-dimethylazaniumyl]propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 90813493 |
| Molecular Formula | C57H79N7O2+2 |
| Molecular Weight | 894.31 g/mol |
| Exact Mass | 893.63 |
| IUPAC Name | decyl-[3-[4-[15-[4-[3-[3-(dimethylamino)propyl-dimethylazaniumyl]propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]-dimethylazanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCOc1ccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3ccc(OCCC[N+](C)(C)CCCN(C)C)cc3)=c3ccc([nH]3)=Cc3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C57H79N7O2/c1-8-9-10-11-12-13-14-15-36-63(4,5)38-17-40-65-50-27-19-44(20-28-50)56-52-31-23-46(58-52)42-48-25-33-54(60-48)57(55-34-26-49(61-55)43-47-24-32-53(56)59-47)45-21-29-51(30-22-45)66-41-18-39-64(6,7)37-16-35-62(2)3/h19-34,42-43,58-61H,8-18,35-41H2,1-7H3/q+2 |
| InChIKey | YACVSAZRGYIFEK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.31 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|