C12H13N3 — CID 90814858
7,8,9,10-tetrahydro-2H-pyrazino[2,3-h][3]benzazepine (PubChem CID 90814858) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 7,8,9,10-tetrahydro-2H-pyrazino[2,3-h][3]benzazepine.
| Compound Name | 7,8,9,10-tetrahydro-2H-pyrazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 90814858 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 7,8,9,10-tetrahydro-2H-pyrazino[2,3-h][3]benzazepine |
| SMILES | C1=Nc2cc3c(cc2=NC1)CCNCC=3 |
| InChI | InChI=1S/C12H13N3/c1-3-13-4-2-10-8-12-11(7-9(1)10)14-5-6-15-12/h1,5,7-8,13H,2-4,6H2 |
| InChIKey | HZOIKUFUNJJILY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |