C7H11N3 — CID 90815776
3a,4,7,7a-tetrahydro-3H-indazol-7-amine (PubChem CID 90815776) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 3a,4,7,7a-tetrahydro-3H-indazol-7-amine.
| Compound Name | 3a,4,7,7a-tetrahydro-3H-indazol-7-amine |
|---|---|
| PubChem CID | 90815776 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 3a,4,7,7a-tetrahydro-3H-indazol-7-amine |
| SMILES | NC1C=CCC2CN=NC12 |
| InChI | InChI=1S/C7H11N3/c8-6-3-1-2-5-4-9-10-7(5)6/h1,3,5-7H,2,4,8H2 |
| InChIKey | ISELNEDTTWOTAT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|