C25H29F3N2O2 — CID 90817158
7-methyl-5-(3-piperidin-4-ylpropyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90817158) has the molecular formula C25H29F3N2O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 7-methyl-5-(3-piperidin-4-ylpropyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-methyl-5-(3-piperidin-4-ylpropyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90817158 |
| Molecular Formula | C25H29F3N2O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 7-methyl-5-(3-piperidin-4-ylpropyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Cc1cc(CCCC2CCNCC2)cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C25H29F3N2O2/c1-17-13-20(4-2-3-18-9-11-29-12-10-18)14-21-16-30(24(31)23(17)21)15-19-5-7-22(8-6-19)32-25(26,27)28/h5-8,13-14,16,18,29,31H,2-4,9-12,15H2,1H3 |
| InChIKey | RVWQIGCZKFVOEY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |