C12H20B5NO2 — CID 90817256
CID 90817256 (PubChem CID 90817256) has the molecular formula C12H20B5NO2 and a molecular weight of 264.36 g/mol.
| Compound Name | CID 90817256 |
|---|---|
| PubChem CID | 90817256 |
| Molecular Formula | C12H20B5NO2 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | — |
| SMILES | CC[C@H](N)B1O[C@H]2[C@H]3C4C(C[C@@]2(C)O1)[C@]43C.[B]B([B])[B] |
| InChI | InChI=1S/C12H20BNO2.B4/c1-4-7(14)13-15-10-9-8-6(12(8,9)3)5-11(10,2)16-13;1-4(2)3/h6-10H,4-5,14H2,1-3H3;/t6?,7-,8?,9+,10-,11+,12+;/m0./s1 |
| InChIKey | JCMJXERFHKAEHL-PUTXBTGLSA-N |
| XLogP | -0.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|