C28H43FN6O3 — CID 90818217
2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-propan-2-ylacetamide (PubChem CID 90818217) has the molecular formula C28H43FN6O3 and a molecular weight of 530.69 g/mol. Its IUPAC name is 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-propan-2-ylacetamide.
| Compound Name | 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 90818217 |
| Molecular Formula | C28H43FN6O3 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-propan-2-ylacetamide |
| SMILES | COc1cc(O)c(C(N)N(c2ccc(CN3CCN(C)CC3)cc2F)C(N)C(=O)NC(C)C)cc1C(C)C |
| InChI | InChI=1S/C28H43FN6O3/c1-17(2)20-14-21(24(36)15-25(20)38-6)26(30)35(27(31)28(37)32-18(3)4)23-8-7-19(13-22(23)29)16-34-11-9-33(5)10-12-34/h7-8,13-15,17-18,26-27,36H,9-12,16,30-31H2,1-6H3,(H,32,37) |
| InChIKey | VRFNSOIEMYHETM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|