C35H53NO6 — CID 90818757
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate (PubChem CID 90818757) has the molecular formula C35H53NO6 and a molecular weight of 583.81 g/mol. Its IUPAC name is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate.
| Compound Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
|---|---|
| PubChem CID | 90818757 |
| Molecular Formula | C35H53NO6 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.39 |
| IUPAC Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
| SMILES | CC(C)CCCC(C)[C@H]1CC[C@H]2C3CC=C4C[C@@H](OC(=O)CCC(=O)On5c(O)ccc5O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C35H53NO6/c1-22(2)7-6-8-23(3)27-11-12-28-26-10-9-24-21-25(17-19-34(24,4)29(26)18-20-35(27,28)5)41-32(39)15-16-33(40)42-36-30(37)13-14-31(36)38/h9,13-14,22-23,25-29,37-38H,6-8,10-12,15-21H2,1-5H3/t23?,25-,26?,27+,28-,29-,34?,35?/m0/s1 |
| InChIKey | ITSDUQXZYIMFRL-YQAHARKFSA-N |
| XLogP | 7.59 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|