C35H53N2+ — CID 90819155
3-heptyl-2-(2-methyl-1,2-diphenyldodecan-3-yl)-1H-imidazol-3-ium (PubChem CID 90819155) has the molecular formula C35H53N2+ and a molecular weight of 501.82 g/mol. Its IUPAC name is 3-heptyl-2-(2-methyl-1,2-diphenyldodecan-3-yl)-1H-imidazol-3-ium.
| Compound Name | 3-heptyl-2-(2-methyl-1,2-diphenyldodecan-3-yl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 90819155 |
| Molecular Formula | C35H53N2+ |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | 3-heptyl-2-(2-methyl-1,2-diphenyldodecan-3-yl)-1H-imidazol-3-ium |
| SMILES | CCCCCCCCCC(c1[nH]cc[n+]1CCCCCCC)C(C)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H52N2/c1-4-6-8-10-11-12-20-26-33(34-36-27-29-37(34)28-21-13-9-7-5-2)35(3,32-24-18-15-19-25-32)30-31-22-16-14-17-23-31/h14-19,22-25,27,29,33H,4-13,20-21,26,28,30H2,1-3H3/p+1 |
| InChIKey | SAVHZIFCSANWBM-UHFFFAOYSA-O |
| XLogP | 9.70 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|