C32H47N2+ — CID 91519557
2-(2-methyl-1,2-diphenylundecan-3-yl)-3-pentyl-1H-imidazol-3-ium (PubChem CID 91519557) has the molecular formula C32H47N2+ and a molecular weight of 459.74 g/mol. Its IUPAC name is 2-(2-methyl-1,2-diphenylundecan-3-yl)-3-pentyl-1H-imidazol-3-ium.
| Compound Name | 2-(2-methyl-1,2-diphenylundecan-3-yl)-3-pentyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 91519557 |
| Molecular Formula | C32H47N2+ |
| Molecular Weight | 459.74 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | 2-(2-methyl-1,2-diphenylundecan-3-yl)-3-pentyl-1H-imidazol-3-ium |
| SMILES | CCCCCCCCC(c1[nH]cc[n+]1CCCCC)C(C)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H46N2/c1-4-6-8-9-10-17-23-30(31-33-24-26-34(31)25-18-7-5-2)32(3,29-21-15-12-16-22-29)27-28-19-13-11-14-20-28/h11-16,19-22,24,26,30H,4-10,17-18,23,25,27H2,1-3H3/p+1 |
| InChIKey | WPSPAQJIESKINZ-UHFFFAOYSA-O |
| XLogP | 8.53 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.74 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|