C11H18N2O6 — CID 90819401
(2,5-dihydroxypyrrol-1-yl) 2-[2-[2-(methylamino)ethoxy]ethoxy]acetate (PubChem CID 90819401) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[2-[2-(methylamino)ethoxy]ethoxy]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[2-[2-(methylamino)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 90819401 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[2-[2-(methylamino)ethoxy]ethoxy]acetate |
| SMILES | CNCCOCCOCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H18N2O6/c1-12-4-5-17-6-7-18-8-11(16)19-13-9(14)2-3-10(13)15/h2-3,12,14-15H,4-8H2,1H3 |
| InChIKey | RTLPOINVMKRGRK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|