C9H9NO8 — CID 91548805
[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl] 2-formyloxyacetate (PubChem CID 91548805) has the molecular formula C9H9NO8 and a molecular weight of 259.17 g/mol. Its IUPAC name is [2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl] 2-formyloxyacetate.
| Compound Name | [2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl] 2-formyloxyacetate |
|---|---|
| PubChem CID | 91548805 |
| Molecular Formula | C9H9NO8 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | [2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl] 2-formyloxyacetate |
| SMILES | O=COCC(=O)OCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C9H9NO8/c11-5-16-3-8(14)17-4-9(15)18-10-6(12)1-2-7(10)13/h1-2,5,12-13H,3-4H2 |
| InChIKey | RGIDEZDPVDGAET-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|