C36H41N5O6S2 — CID 90819636
cyclopentyl N-[(1S,4R,6S,14S,18R)-4-formyl-2,15-dioxo-18-[6-oxo-4,5-di(thiophen-3-yl)pyridazin-1-yl]-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 90819636) has the molecular formula C36H41N5O6S2 and a molecular weight of 703.89 g/mol. Its IUPAC name is cyclopentyl N-[(1S,4R,6S,14S,18R)-4-formyl-2,15-dioxo-18-[6-oxo-4,5-di(thiophen-3-yl)pyridazin-1-yl]-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | cyclopentyl N-[(1S,4R,6S,14S,18R)-4-formyl-2,15-dioxo-18-[6-oxo-4,5-di(thiophen-3-yl)pyridazin-1-yl]-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 90819636 |
| Molecular Formula | C36H41N5O6S2 |
| Molecular Weight | 703.89 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | cyclopentyl N-[(1S,4R,6S,14S,18R)-4-formyl-2,15-dioxo-18-[6-oxo-4,5-di(thiophen-3-yl)pyridazin-1-yl]-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | O=C[C@@]12C[C@H]1C=CCCCCC[C@H](NC(=O)OC1CCCC1)C(=O)N1C[C@H](n3ncc(-c4ccsc4)c(-c4ccsc4)c3=O)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C36H41N5O6S2/c42-22-36-17-25(36)8-4-2-1-3-5-11-29(38-35(46)47-27-9-6-7-10-27)33(44)40-19-26(16-30(40)32(43)39-36)41-34(45)31(24-13-15-49-21-24)28(18-37-41)23-12-14-48-20-23/h4,8,12-15,18,20-22,25-27,29-30H,1-3,5-7,9-11,16-17,19H2,(H,38,46)(H,39,43)/t25-,26-,29+,30+,36+/m1/s1 |
| InChIKey | TZLQDNGWWDCSOK-IEVQUKMUSA-N |
| XLogP | 5.47 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|