C20H17NO3 — CID 90822779
methyl 4-benzyl-2-oxo-6-phenyl-1H-pyridine-3-carboxylate (PubChem CID 90822779) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 4-benzyl-2-oxo-6-phenyl-1H-pyridine-3-carboxylate.
| Compound Name | methyl 4-benzyl-2-oxo-6-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90822779 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 4-benzyl-2-oxo-6-phenyl-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(Cc2ccccc2)cc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C20H17NO3/c1-24-20(23)18-16(12-14-8-4-2-5-9-14)13-17(21-19(18)22)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3,(H,21,22) |
| InChIKey | TVZJOMBTIRHVMQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |