C33H52ClN11O9 — CID 90826592
15-[[2-acetamido-5-(aminomethylamino)pentanoyl]amino]-9-[(2-chlorophenyl)methyl]-14-hydroxy-2,5,8,11,17-pentaoxo-1,4,7,10,13,18-hexazacyclotricosane-23-carboxamide (PubChem CID 90826592) has the molecular formula C33H52ClN11O9 and a molecular weight of 782.30 g/mol. Its IUPAC name is 15-[[2-acetamido-5-(aminomethylamino)pentanoyl]amino]-9-[(2-chlorophenyl)methyl]-14-hydroxy-2,5,8,11,17-pentaoxo-1,4,7,10,13,18-hexazacyclotricosane-23-carboxamide.
| Compound Name | 15-[[2-acetamido-5-(aminomethylamino)pentanoyl]amino]-9-[(2-chlorophenyl)methyl]-14-hydroxy-2,5,8,11,17-pentaoxo-1,4,7,10,13,18-hexazacyclotricosane-23-carboxamide |
|---|---|
| PubChem CID | 90826592 |
| Molecular Formula | C33H52ClN11O9 |
| Molecular Weight | 782.30 g/mol |
| Exact Mass | 781.36 |
| IUPAC Name | 15-[[2-acetamido-5-(aminomethylamino)pentanoyl]amino]-9-[(2-chlorophenyl)methyl]-14-hydroxy-2,5,8,11,17-pentaoxo-1,4,7,10,13,18-hexazacyclotricosane-23-carboxamide |
| SMILES | CC(=O)NC(CCCNCN)C(=O)NC1CC(=O)NCCCCC(C(N)=O)NC(=O)CNC(=O)CNC(=O)C(Cc2ccccc2Cl)NC(=O)CNC1O |
| InChI | InChI=1S/C33H52ClN11O9/c1-19(46)42-23(10-6-11-37-18-35)33(54)45-25-14-26(47)38-12-5-4-9-22(30(36)51)43-28(49)16-39-27(48)15-40-31(52)24(44-29(50)17-41-32(25)53)13-20-7-2-3-8-21(20)34/h2-3,7-8,22-25,32,37,41,53H,4-6,9-18,35H2,1H3,(H2,36,51)(H,38,47)(H,39,48)(H,40,52)(H,42,46)(H,43,49)(H,44,50)(H,45,54) |
| InChIKey | BCCNQKCIEBYPFD-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 317.10 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.30 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|