C30H40F3N9O9 — CID 91475885
22-[(2-acetamidoacetyl)amino]-3,6,9,12,17,23-hexaoxo-5-[[2-(trifluoromethyl)phenyl]methyl]-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide (PubChem CID 91475885) has the molecular formula C30H40F3N9O9 and a molecular weight of 727.70 g/mol. Its IUPAC name is 22-[(2-acetamidoacetyl)amino]-3,6,9,12,17,23-hexaoxo-5-[[2-(trifluoromethyl)phenyl]methyl]-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide.
| Compound Name | 22-[(2-acetamidoacetyl)amino]-3,6,9,12,17,23-hexaoxo-5-[[2-(trifluoromethyl)phenyl]methyl]-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide |
|---|---|
| PubChem CID | 91475885 |
| Molecular Formula | C30H40F3N9O9 |
| Molecular Weight | 727.70 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | 22-[(2-acetamidoacetyl)amino]-3,6,9,12,17,23-hexaoxo-5-[[2-(trifluoromethyl)phenyl]methyl]-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide |
| SMILES | CC(=O)NCC(=O)NC1CCCNC(=O)CCC(C(N)=O)NC(=O)CNC(=O)CNC(=O)C(Cc2ccccc2C(F)(F)F)NC(=O)CNC1=O |
| InChI | InChI=1S/C30H40F3N9O9/c1-16(43)36-13-24(46)41-20-7-4-10-35-22(44)9-8-19(27(34)49)40-25(47)14-37-23(45)12-38-29(51)21(42-26(48)15-39-28(20)50)11-17-5-2-3-6-18(17)30(31,32)33/h2-3,5-6,19-21H,4,7-15H2,1H3,(H2,34,49)(H,35,44)(H,36,43)(H,37,45)(H,38,51)(H,39,50)(H,40,47)(H,41,46)(H,42,48) |
| InChIKey | WRXVRYDJDIXPHE-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 275.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.70 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |