C33H49N9O9 — CID 91007678
22-[(2-acetamidoacetyl)amino]-5-[(4-tert-butylphenyl)methyl]-3,6,9,12,19,23-hexaoxo-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide (PubChem CID 91007678) has the molecular formula C33H49N9O9 and a molecular weight of 715.81 g/mol. Its IUPAC name is 22-[(2-acetamidoacetyl)amino]-5-[(4-tert-butylphenyl)methyl]-3,6,9,12,19,23-hexaoxo-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide.
| Compound Name | 22-[(2-acetamidoacetyl)amino]-5-[(4-tert-butylphenyl)methyl]-3,6,9,12,19,23-hexaoxo-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide |
|---|---|
| PubChem CID | 91007678 |
| Molecular Formula | C33H49N9O9 |
| Molecular Weight | 715.81 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | 22-[(2-acetamidoacetyl)amino]-5-[(4-tert-butylphenyl)methyl]-3,6,9,12,19,23-hexaoxo-1,4,7,10,13,18-hexazacyclotricosane-14-carboxamide |
| SMILES | CC(=O)NCC(=O)NC1CCC(=O)NCCCC(C(N)=O)NC(=O)CNC(=O)CNC(=O)C(Cc2ccc(C(C)(C)C)cc2)NC(=O)CNC1=O |
| InChI | InChI=1S/C33H49N9O9/c1-19(43)36-16-27(46)41-23-11-12-25(44)35-13-5-6-22(30(34)49)40-28(47)17-37-26(45)15-38-32(51)24(42-29(48)18-39-31(23)50)14-20-7-9-21(10-8-20)33(2,3)4/h7-10,22-24H,5-6,11-18H2,1-4H3,(H2,34,49)(H,35,44)(H,36,43)(H,37,45)(H,38,51)(H,39,50)(H,40,47)(H,41,46)(H,42,48) |
| InChIKey | VVTAVGWHMNHEOB-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 275.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.81 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |