C22H29FN2O4 — CID 90828536
2-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl N-tert-butylcarbamate (PubChem CID 90828536) has the molecular formula C22H29FN2O4 and a molecular weight of 404.48 g/mol. Its IUPAC name is 2-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90828536 |
| Molecular Formula | C22H29FN2O4 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl N-tert-butylcarbamate |
| SMILES | COc1cc(CNCCOC(=O)NC(C)(C)C)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C22H29FN2O4/c1-22(2,3)25-21(26)28-12-11-24-14-16-9-10-19(20(13-16)27-4)29-15-17-7-5-6-8-18(17)23/h5-10,13,24H,11-12,14-15H2,1-4H3,(H,25,26) |
| InChIKey | GEYDSXYEWUXGPV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|