About N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide
N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide (PubChem CID 90829368) has the molecular formula C19H17NO2
and a molecular weight of 291.35 g/mol. Its IUPAC name is N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide |
| PubChem CID | 90829368 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide |
| SMILES | C#CCN(C)C(=O)C1Cc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C19H17NO2/c1-3-12-20(2)19(21)16-13-14-8-4-6-10-17(14)22-18-11-7-5-9-15(16)18/h1,4-11,16H,12-13H2,2H3 |
| InChIKey | VISDLRQUFAHBJK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide?
The IUPAC name of N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide (CID 90829368) is N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide.
What is the SMILES notation for N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide?
The canonical SMILES for N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide is C#CCN(C)C(=O)C1Cc2ccccc2Oc2ccccc21.
What is the InChIKey of N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide?
The InChIKey is VISDLRQUFAHBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO2/c1-3-12-20(2)19(21)16-13-14-8-4-6-10-17(14)22-18-11-7-5-9-15(16)18/h1,4-11,16H,12-13H2,2H3.
What are the key properties of N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide?
N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide has a molecular weight of 291.35 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-prop-2-ynyl-5,6-dihydrobenzo[b][1]benzoxepine-5-carboxamide is sourced from PubChem (CID 90829368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).