About cinnoline-3-carboxylic acid;ethane
cinnoline-3-carboxylic acid;ethane (PubChem CID 90831322) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is cinnoline-3-carboxylic acid;ethane.
Molecular Properties
| Compound Name | cinnoline-3-carboxylic acid;ethane |
| PubChem CID | 90831322 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | cinnoline-3-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1cc2ccccc2nn1 |
| InChI | InChI=1S/C9H6N2O2.C2H6/c12-9(13)8-5-6-3-1-2-4-7(6)10-11-8;1-2/h1-5H,(H,12,13);1-2H3 |
| InChIKey | OQQSPMNIQZGESC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cinnoline-3-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline-3-carboxylic acid;ethane?
The IUPAC name of cinnoline-3-carboxylic acid;ethane (CID 90831322) is cinnoline-3-carboxylic acid;ethane.
What is the SMILES notation for cinnoline-3-carboxylic acid;ethane?
The canonical SMILES for cinnoline-3-carboxylic acid;ethane is CC.O=C(O)c1cc2ccccc2nn1.
What is the InChIKey of cinnoline-3-carboxylic acid;ethane?
The InChIKey is OQQSPMNIQZGESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.C2H6/c12-9(13)8-5-6-3-1-2-4-7(6)10-11-8;1-2/h1-5H,(H,12,13);1-2H3.
What are the key properties of cinnoline-3-carboxylic acid;ethane?
cinnoline-3-carboxylic acid;ethane has a molecular weight of 204.23 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline-3-carboxylic acid;ethane is sourced from PubChem (CID 90831322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).