C19H18F3NO — CID 90832568
[3-[[2-(methylideneamino)-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 90832568) has the molecular formula C19H18F3NO and a molecular weight of 333.35 g/mol. Its IUPAC name is [3-[[2-(methylideneamino)-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [3-[[2-(methylideneamino)-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 90832568 |
| Molecular Formula | C19H18F3NO |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [3-[[2-(methylideneamino)-2,3-dihydro-1H-inden-5-yl]methyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | C=NC1Cc2ccc(Cc3cc(CO)cc(C(F)(F)F)c3)cc2C1 |
| InChI | InChI=1S/C19H18F3NO/c1-23-18-9-15-3-2-12(6-16(15)10-18)4-13-5-14(11-24)8-17(7-13)19(20,21)22/h2-3,5-8,18,24H,1,4,9-11H2 |
| InChIKey | IDKYBPWFBHFLEF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|