C21H42 — CID 90833224
7-ethyl-3,4,5,7-tetramethyl-6-(2-methylpropyl)undec-1-ene (PubChem CID 90833224) has the molecular formula C21H42 and a molecular weight of 294.57 g/mol. Its IUPAC name is 7-ethyl-3,4,5,7-tetramethyl-6-(2-methylpropyl)undec-1-ene.
| Compound Name | 7-ethyl-3,4,5,7-tetramethyl-6-(2-methylpropyl)undec-1-ene |
|---|---|
| PubChem CID | 90833224 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 7-ethyl-3,4,5,7-tetramethyl-6-(2-methylpropyl)undec-1-ene |
| SMILES | C=CC(C)C(C)C(C)C(CC(C)C)C(C)(CC)CCCC |
| InChI | InChI=1S/C21H42/c1-10-13-14-21(9,12-3)20(15-16(4)5)19(8)18(7)17(6)11-2/h11,16-20H,2,10,12-15H2,1,3-9H3 |
| InChIKey | JFPYEAALYQHUNZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|