C19H38 — CID 123319069
7-ethenyl-6-ethyl-3,5,6,7-tetramethylundecane (PubChem CID 123319069) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 7-ethenyl-6-ethyl-3,5,6,7-tetramethylundecane.
| Compound Name | 7-ethenyl-6-ethyl-3,5,6,7-tetramethylundecane |
|---|---|
| PubChem CID | 123319069 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 7-ethenyl-6-ethyl-3,5,6,7-tetramethylundecane |
| SMILES | C=CC(C)(CCCC)C(C)(CC)C(C)CC(C)CC |
| InChI | InChI=1S/C19H38/c1-9-13-14-18(7,11-3)19(8,12-4)17(6)15-16(5)10-2/h11,16-17H,3,9-10,12-15H2,1-2,4-8H3 |
| InChIKey | OSSBLWKJUDYIFE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|