C19H26O5 — CID 90835282
(8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-1,4,5,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6-trione (PubChem CID 90835282) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-1,4,5,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6-trione.
| Compound Name | (8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-1,4,5,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6-trione |
|---|---|
| PubChem CID | 90835282 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (8S,9S,10R,11R,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-1,4,5,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6-trione |
| SMILES | C[C@]12C[C@@H](O)[C@H]3[C@@H](CC(=O)C4CC(=O)C(=O)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H26O5/c1-18-8-15(23)17-9(10(18)3-4-16(18)24)5-12(20)11-6-13(21)14(22)7-19(11,17)2/h9-11,15-17,23-24H,3-8H2,1-2H3/t9-,10-,11?,15+,16-,17+,18-,19-/m0/s1 |
| InChIKey | VBNQKCZOYAPCOQ-KKRFOSMWSA-N |
| XLogP | 1.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|