C19H34N4O3 — CID 90836976
N-[1-(1-acetyl-6a-methyl-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide (PubChem CID 90836976) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[1-(1-acetyl-6a-methyl-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide.
| Compound Name | N-[1-(1-acetyl-6a-methyl-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 90836976 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | N-[1-(1-acetyl-6a-methyl-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-4-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2(C)C1CCN2C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C19H34N4O3/c1-12(20-7)16(25)21-15(18(3,4)5)17(26)22-11-9-19(6)14(22)8-10-23(19)13(2)24/h12,14-15,20H,8-11H2,1-7H3,(H,21,25) |
| InChIKey | HJEJCBSOKZBEJG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |