C28H36O5S — CID 90837398
(8S,9S,10R,13S,14S,17S)-17-acetyl-12-hydroxy-10,13-dimethyl-1-(4-methylphenyl)sulfonyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 90837398) has the molecular formula C28H36O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-acetyl-12-hydroxy-10,13-dimethyl-1-(4-methylphenyl)sulfonyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-12-hydroxy-10,13-dimethyl-1-(4-methylphenyl)sulfonyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90837398 |
| Molecular Formula | C28H36O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-12-hydroxy-10,13-dimethyl-1-(4-methylphenyl)sulfonyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC(S(=O)(=O)c5ccc(C)cc5)[C@]4(C)[C@H]3CC(O)[C@]12C |
| InChI | InChI=1S/C28H36O5S/c1-16-5-8-20(9-6-16)34(32,33)26-14-19(30)13-18-7-10-21-23-12-11-22(17(2)29)28(23,4)25(31)15-24(21)27(18,26)3/h5-6,8-9,13,21-26,31H,7,10-12,14-15H2,1-4H3/t21-,22+,23-,24-,25?,26?,27-,28+/m0/s1 |
| InChIKey | ULZIYJSYYWWCHT-AUSZVCKJSA-N |
| XLogP | 4.46 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |