C30H34N4O4 — CID 90837869
(2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-[(4-methoxyphenyl)methyl]-2-pentyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione (PubChem CID 90837869) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-[(4-methoxyphenyl)methyl]-2-pentyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione.
| Compound Name | (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-[(4-methoxyphenyl)methyl]-2-pentyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione |
|---|---|
| PubChem CID | 90837869 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-[(4-methoxyphenyl)methyl]-2-pentyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione |
| SMILES | CCCCC[C@]12c3ccccc3N(Cc3ccc(OC)cc3)C(=O)CN1C(=O)[C@H]2Oc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C30H34N4O4/c1-5-6-9-16-30-24-10-7-8-11-25(24)33(18-22-12-14-23(37-4)15-13-22)26(35)19-34(30)28(36)27(30)38-29-31-20(2)17-21(3)32-29/h7-8,10-15,17,27H,5-6,9,16,18-19H2,1-4H3/t27-,30-/m1/s1 |
| InChIKey | VASHMJNWGYFMRN-POURPWNDSA-N |
| XLogP | 4.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|