C25H21F3N4O3 — CID 90917577
(2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-methyl-2-[3-(trifluoromethyl)phenyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione (PubChem CID 90917577) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-methyl-2-[3-(trifluoromethyl)phenyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione.
| Compound Name | (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-methyl-2-[3-(trifluoromethyl)phenyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione |
|---|---|
| PubChem CID | 90917577 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (2R,3S)-3-(4,6-dimethylpyrimidin-2-yl)oxy-8-methyl-2-[3-(trifluoromethyl)phenyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-triene-4,7-dione |
| SMILES | Cc1cc(C)nc(O[C@@H]2C(=O)N3CC(=O)N(C)c4ccccc4[C@]23c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C25H21F3N4O3/c1-14-11-15(2)30-23(29-14)35-21-22(34)32-13-20(33)31(3)19-10-5-4-9-18(19)24(21,32)16-7-6-8-17(12-16)25(26,27)28/h4-12,21H,13H2,1-3H3/t21-,24-/m1/s1 |
| InChIKey | FNKCDLXHUDEVHV-ZJSXRUAMSA-N |
| XLogP | 3.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |