C26H24N2O4 — CID 69413268
(2S,3S)-11-methoxy-8-methyl-2-phenyl-3-phenylmethoxy-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione (PubChem CID 69413268) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S,3S)-11-methoxy-8-methyl-2-phenyl-3-phenylmethoxy-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione.
| Compound Name | (2S,3S)-11-methoxy-8-methyl-2-phenyl-3-phenylmethoxy-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione |
|---|---|
| PubChem CID | 69413268 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (2S,3S)-11-methoxy-8-methyl-2-phenyl-3-phenylmethoxy-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione |
| SMILES | COc1ccc2c(c1)N(C)C(=O)CN1C(=O)[C@@H](OCc3ccccc3)[C@]21c1ccccc1 |
| InChI | InChI=1S/C26H24N2O4/c1-27-22-15-20(31-2)13-14-21(22)26(19-11-7-4-8-12-19)24(25(30)28(26)16-23(27)29)32-17-18-9-5-3-6-10-18/h3-15,24H,16-17H2,1-2H3/t24-,26+/m1/s1 |
| InChIKey | HKHVENUCNSGWEE-RSXGOPAZSA-N |
| XLogP | 3.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |