C19H18N2O4 — CID 91010704
(2R,3S)-3-hydroxy-11-methoxy-8-methyl-2-phenyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione (PubChem CID 91010704) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-11-methoxy-8-methyl-2-phenyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione.
| Compound Name | (2R,3S)-3-hydroxy-11-methoxy-8-methyl-2-phenyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione |
|---|---|
| PubChem CID | 91010704 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2R,3S)-3-hydroxy-11-methoxy-8-methyl-2-phenyl-5,8-diazatricyclo[7.4.0.02,5]trideca-1(9),10,12-triene-4,7-dione |
| SMILES | COc1ccc2c(c1)N(C)C(=O)CN1C(=O)[C@@H](O)[C@@]21c1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c1-20-15-10-13(25-2)8-9-14(15)19(12-6-4-3-5-7-12)17(23)18(24)21(19)11-16(20)22/h3-10,17,23H,11H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | PLVOWFUFBQXYSI-IEBWSBKVSA-N |
| XLogP | 1.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |