C13H10N4O2S2 — CID 90838638
7-methyl-4-(thiophen-2-ylmethyldiazenyl)thieno[3,2-d]pyrimidine-6-carboxylic acid (PubChem CID 90838638) has the molecular formula C13H10N4O2S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 7-methyl-4-(thiophen-2-ylmethyldiazenyl)thieno[3,2-d]pyrimidine-6-carboxylic acid.
| Compound Name | 7-methyl-4-(thiophen-2-ylmethyldiazenyl)thieno[3,2-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 90838638 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 7-methyl-4-(thiophen-2-ylmethyldiazenyl)thieno[3,2-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2c(/N=N/Cc3cccs3)ncnc12 |
| InChI | InChI=1S/C13H10N4O2S2/c1-7-9-11(21-10(7)13(18)19)12(15-6-14-9)17-16-5-8-3-2-4-20-8/h2-4,6H,5H2,1H3,(H,18,19)/b17-16+ |
| InChIKey | LORVEKODZGCPHA-WUKNDPDISA-N |
| XLogP | 4.04 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|