C9H10N2O — CID 90838911
3-methyl-5,8-dihydropyrido[1,2-c]pyrimidin-1-one (PubChem CID 90838911) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-methyl-5,8-dihydropyrido[1,2-c]pyrimidin-1-one.
| Compound Name | 3-methyl-5,8-dihydropyrido[1,2-c]pyrimidin-1-one |
|---|---|
| PubChem CID | 90838911 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-methyl-5,8-dihydropyrido[1,2-c]pyrimidin-1-one |
| SMILES | Cc1cc2n(c(=O)n1)CC=CC2 |
| InChI | InChI=1S/C9H10N2O/c1-7-6-8-4-2-3-5-11(8)9(12)10-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | RGFACVLHQDIZMR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|