C15H24N2O5S — CID 90839007
3-[(4-methoxyphenyl)sulfonylamino]propyl N-tert-butylcarbamate (PubChem CID 90839007) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfonylamino]propyl N-tert-butylcarbamate.
| Compound Name | 3-[(4-methoxyphenyl)sulfonylamino]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90839007 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfonylamino]propyl N-tert-butylcarbamate |
| SMILES | COc1ccc(S(=O)(=O)NCCCOC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)17-14(18)22-11-5-10-16-23(19,20)13-8-6-12(21-4)7-9-13/h6-9,16H,5,10-11H2,1-4H3,(H,17,18) |
| InChIKey | YMBIPMMEBUXGIU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|