C21H30ClN7O2S — CID 90839037
N-[(1R,2R)-2-[[5-chloro-2-[methyl(2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide (PubChem CID 90839037) has the molecular formula C21H30ClN7O2S and a molecular weight of 480.04 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[methyl(2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[methyl(2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 90839037 |
| Molecular Formula | C21H30ClN7O2S |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[methyl(2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-yl)amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
| SMILES | CN(c1ccc2c(c1)NCCNC2)c1ncc(Cl)c(N[C@@H]2CCCC[C@H]2NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C21H30ClN7O2S/c1-29(15-8-7-14-12-23-9-10-24-19(14)11-15)21-25-13-16(22)20(27-21)26-17-5-3-4-6-18(17)28-32(2,30)31/h7-8,11,13,17-18,23-24,28H,3-6,9-10,12H2,1-2H3,(H,25,26,27)/t17-,18-/m1/s1 |
| InChIKey | VZLYKUFQRUTMKM-QZTJIDSGSA-N |
| XLogP | 2.69 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |