C24H22N4O4 — CID 90840324
3-[3-(furan-2-carbonylamino)phenyl]-1-(oxan-2-yl)indazole-4-carboxamide (PubChem CID 90840324) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[3-(furan-2-carbonylamino)phenyl]-1-(oxan-2-yl)indazole-4-carboxamide.
| Compound Name | 3-[3-(furan-2-carbonylamino)phenyl]-1-(oxan-2-yl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 90840324 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-[3-(furan-2-carbonylamino)phenyl]-1-(oxan-2-yl)indazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c(-c1cccc(NC(=O)c3ccco3)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C24H22N4O4/c25-23(29)17-8-4-9-18-21(17)22(27-28(18)20-11-1-2-12-32-20)15-6-3-7-16(14-15)26-24(30)19-10-5-13-31-19/h3-10,13-14,20H,1-2,11-12H2,(H2,25,29)(H,26,30) |
| InChIKey | LNPIGSWDRMINEB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |