C33H52O7 — CID 90840685
7-[(4S)-6-ethyl-4,5-dimethyl-3-(3-methylbutanoyloxy)oxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 90840685) has the molecular formula C33H52O7 and a molecular weight of 560.77 g/mol. Its IUPAC name is 7-[(4S)-6-ethyl-4,5-dimethyl-3-(3-methylbutanoyloxy)oxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | 7-[(4S)-6-ethyl-4,5-dimethyl-3-(3-methylbutanoyloxy)oxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 90840685 |
| Molecular Formula | C33H52O7 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | 7-[(4S)-6-ethyl-4,5-dimethyl-3-(3-methylbutanoyloxy)oxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C1C2CCC3C4(C)CC(OC5OC(CC)C(C)[C@H](C)C5OC(=O)CC(C)C)CC(C(=O)O)C4CCC3(C2)C1O |
| InChI | InChI=1S/C33H52O7/c1-8-25-18(4)19(5)28(40-27(34)13-17(2)3)31(39-25)38-22-14-23(30(36)37)24-11-12-33-15-21(20(6)29(33)35)9-10-26(33)32(24,7)16-22/h17-19,21-26,28-29,31,35H,6,8-16H2,1-5,7H3,(H,36,37)/t18?,19-,21?,22?,23?,24?,25?,26?,28?,29?,31?,32?,33?/m0/s1 |
| InChIKey | LPKJPXYHEJXCMK-VMKMWMMMSA-N |
| XLogP | 5.98 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|