C32H49O11S- — CID 91179550
7-[(4R)-6-ethyl-4-methyl-3-(3-methylbutanoyloxy)-5-oxidoperoxyoxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid;sulfur monoxide (PubChem CID 91179550) has the molecular formula C32H49O11S- and a molecular weight of 641.80 g/mol. Its IUPAC name is 7-[(4R)-6-ethyl-4-methyl-3-(3-methylbutanoyloxy)-5-oxidoperoxyoxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid;sulfur monoxide.
| Compound Name | 7-[(4R)-6-ethyl-4-methyl-3-(3-methylbutanoyloxy)-5-oxidoperoxyoxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid;sulfur monoxide |
|---|---|
| PubChem CID | 91179550 |
| Molecular Formula | C32H49O11S- |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | 7-[(4R)-6-ethyl-4-methyl-3-(3-methylbutanoyloxy)-5-oxidoperoxyoxan-2-yl]oxy-15-hydroxy-9-methyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid;sulfur monoxide |
| SMILES | C=C1C2CCC3C4(C)CC(OC5OC(CC)C(OO[O-])[C@H](C)C5OC(=O)CC(C)C)CC(C(=O)O)C4CCC3(C2)C1O.O=S |
| InChI | InChI=1S/C32H50O10.OS/c1-7-23-26(41-42-37)18(5)27(40-25(33)12-16(2)3)30(39-23)38-20-13-21(29(35)36)22-10-11-32-14-19(17(4)28(32)34)8-9-24(32)31(22,6)15-20;1-2/h16,18-24,26-28,30,34,37H,4,7-15H2,1-3,5-6H3,(H,35,36);/p-1/t18-,19?,20?,21?,22?,23?,24?,26?,27?,28?,30?,31?,32?;/m0./s1 |
| InChIKey | FIBQMLMJWCZFNH-YFNVSIOUSA-M |
| XLogP | 3.60 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|