C9H12F3N — CID 90841668
5-propan-2-yl-2-(trifluoromethyl)-2,5-dihydropyridine (PubChem CID 90841668) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is 5-propan-2-yl-2-(trifluoromethyl)-2,5-dihydropyridine.
| Compound Name | 5-propan-2-yl-2-(trifluoromethyl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 90841668 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-propan-2-yl-2-(trifluoromethyl)-2,5-dihydropyridine |
| SMILES | CC(C)C1C=CC(C(F)(F)F)N=C1 |
| InChI | InChI=1S/C9H12F3N/c1-6(2)7-3-4-8(13-5-7)9(10,11)12/h3-8H,1-2H3 |
| InChIKey | PSKDSABTOOQWGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|