C8H11NO4 — CID 90842444
1-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutan-1-one (PubChem CID 90842444) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutan-1-one.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutan-1-one |
|---|---|
| PubChem CID | 90842444 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutan-1-one |
| SMILES | CCC(O)C(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C8H11NO4/c1-2-5(10)8(13)9-6(11)3-4-7(9)12/h3-5,10-12H,2H2,1H3 |
| InChIKey | FRMWTEFVTBYAAX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |