C9H13NO4 — CID 54247356
butyl 2,5-dihydroxypyrrole-1-carboxylate (PubChem CID 54247356) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is butyl 2,5-dihydroxypyrrole-1-carboxylate.
| Compound Name | butyl 2,5-dihydroxypyrrole-1-carboxylate |
|---|---|
| PubChem CID | 54247356 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | butyl 2,5-dihydroxypyrrole-1-carboxylate |
| SMILES | CCCCOC(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C9H13NO4/c1-2-3-6-14-9(13)10-7(11)4-5-8(10)12/h4-5,11-12H,2-3,6H2,1H3 |
| InChIKey | QUEZCIVLKIWYDW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|