C25H28F3N3O2S — CID 90843532
O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(4-tert-butylphenyl)carbamothioate (PubChem CID 90843532) has the molecular formula C25H28F3N3O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(4-tert-butylphenyl)carbamothioate.
| Compound Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(4-tert-butylphenyl)carbamothioate |
|---|---|
| PubChem CID | 90843532 |
| Molecular Formula | C25H28F3N3O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(4-tert-butylphenyl)carbamothioate |
| SMILES | CC(C)(C)c1ccc(NC(=S)ON2CCC3(C=C(c4ccc(C(F)(F)F)cc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C25H28F3N3O2S/c1-23(2,3)18-8-10-20(11-9-18)29-22(34)32-31-14-12-24(13-15-31)16-21(30-33-24)17-4-6-19(7-5-17)25(26,27)28/h4-11,16,30H,12-15H2,1-3H3,(H,29,34) |
| InChIKey | ZIPZJIPNULJFQR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|